Product Overview
Uric Acid | T0626 | TargetMol Chemicals
CAS: 69-93-2
Smiles: O=c1[nH]c2[nH]c(=O)[nH]c(=O)c2[nH]1
Formula: C5H4N4O3
Pathway: Immunology/Inflammation|||Metabolism|||NF-Κb
Target: Reactive Oxygen Species|||Endogenous Metabolite|||Phosphorylase
Receptor: N/A
Bioactivity: Uric acid is an oxidation product of oxypurines such as XANTHINE and HYPOXANTHINE. It is the final oxidation product of purine catabolism in humans and primates, whereas in most other mammals URATE OXIDASE further oxidizes it to ALLANTOIN.
Molecular Weight: 168, 112
