Product Overview
Volvaltrate B | TN5249 | TargetMol Chemicals
CAS: 1181224-13-4
Smiles: CC(C)CC(=O)O[C@H](C(C)C)C(=O)OCC1=CO[C@@H](OC(=O)CC(C)C)C2[C@@](O)(CCl)[C@H](C[C@]12O)OC(C)=O
Formula: C27H41ClO11
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Volvaltrate B shows cytotoxic activity against the lung adenocarcinoma (A549), metastatic prostate cancer (PC-3M), colon cancer (HCT-8), and hepatoma (Bel7402) cell lines, with IC50 values of 8.5, 2.0, 3.2, and 6.1 uM, respectively.
Molecular Weight: 577, 06
