Product Overview
17α-Hydroxyprogesterone | T1429 | TargetMol Chemicals
CAS: 68-96-2
Smiles: CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
Formula: C21H30O3
Pathway: Endocrinology/Hormones|||Metabolism|||Others
Target: Estrogen/progestogen Receptor|||Progesterone Receptor|||Endogenous Metabolite
Receptor: N/A
Bioactivity: Hydroxyprogesterone is a physiological progestin that is produced during glucocorticoid and steroid hormone synthesis and is increased during the third trimester of pregnancy. Hydroxyprogesterone binds to the cytoplasmic progesterone receptors in the reproductive system and subsequently activates progesterone receptor-mediated gene expression.
Molecular Weight: 330, 468
