Product Overview
Cortisone acetate | T0034 | TargetMol Chemicals
CAS: 50-04-4
Smiles: CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C
Formula: C23H30O6
Pathway: Endocrinology/Hormones|||Metabolism
Target: Glucocorticoid Receptor|||Endogenous Metabolite
Receptor: N/A
Bioactivity: Cortisone Acetate is the acetate salt form of cortisone, a synthetic or semisynthetic analog of the naturally occurring cortisone hormone produced by the adrenal glands with anti-inflammatory and immunomodulating properties. Cortisone acetate diffuses through the cell membrane and binds to nuclear glucocorticoid receptors. The receptor-ligand complex binds to promotor regions of certain genes and initiates RNA transcription. This results in an induction of synthesis of certain anti-inflammatory proteins while inhibiting the synthesis of certain inflammatory mediators.
Molecular Weight: 402, 49
