immunoglobulin light chain variable region fragment [Homo sapiens] | T22865

immunoglobulin light chain variable region fragment [Homo sapiens] | T22865 | TargetMol Chemicals

CAS: T22865

Smiles: NC(C(NC(C(C)O)C(NC(CC(C)C)C(NC(CCCCN)C(NC(C(C)CC)C(NC(CO)C(NC(CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)CC1=CC=CC=C1

Formula: C40H69N11O10

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Immunoglobulin light chain variable region fragment [Homo sapiens] is a fragment (Phe-Thr-Leu-Lys-Ile-Ser-Arg) on the variable region of the human immunoglobulin light chain.

Molecular Weight: 864, 04