Immunoglobulin M heavy chain (IGHM) fragment [Homo sapiens] | TP2260

Immunoglobulin M heavy chain (IGHM) fragment [Homo sapiens] | TP2260 | TargetMol Chemicals

CAS: TP2260

Smiles: O=C(N[C@]([H])(C(=O)N[C@](C)([H])C(=O)N[C@@]([H])(CC(C)(C)[H])C(=O)N[C@@]([H])(C/C1=C/NC=N1)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N2CCC[C@]2([H])C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(C/C3=C/C=C(/O)C=C3)C(=O)N[C@@]([H])(CC(C)(C)[H])C(=O)N[C@@]([H])(CC(C)(C)[H])C(=O)N4CCC[C@]4([H])C(=O)N5CCC[C@]5([H])C(=O)N[C@](C)([H])C(=O)N[C@]([H])(CCCNC(N)=N)C(O)=O)C(C)(C)[H])C(C)(C)[H])CN

Formula: C82H132N24O20

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Immunoglobulin M heavy chain (IGHM) fragment [Homo sapiens] is a fragment (Gly-Val-Ala-Leu-His-Arg-Pro-Asp-Val-Tyr-Leu-Leu-Pro-Pro-Ala-Arg) on the human immunoglobulin micro heavy chain. Immunoglobulins (Ig) are the antigen recognition molecules of B cells. An Ig molecule is made up of 2 identical heavy chains and 2 identical light chains joined by disulfide bonds so that each heavy chain is linked to a light chain and the 2 heavy chains are linked together. Each Ig heavy chain has an N-terminal variable (V) region containing the antigen-binding site and a C-terminal constant (C) region, encoded by an individual C region gene, that determines the isotype of the antibody and provides effector or signaling functions.

Molecular Weight: 1774, 07