p53 tumor suppressor fragment | TP2281

p53 tumor suppressor fragment | TP2281 | TargetMol Chemicals

CAS: TP2281

Smiles: NC(CCCCN)C(NC(CC1=CC=C(O)C=C1)C(NC(CCSC)C(NC(CS)C(NC(CC(N)=O)C(NC(CO)C(NC(CO)C(NC(CS)C(NC(CCSC)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O

Formula: C41H67N11O14S4

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: p53 tumor suppressor fragment (232-240) is a peptide with the sequence H2N-Lys-Tyr-Met-Cys-Asn-Ser-Ser-Cys-Met-OH, MW= 1066.3. p53 is a tumor suppressor protein that in humans is encoded by the TP53 gene. p53 is crucial in multicellular organisms, where it regulates the cell cycle and, thus, functions as a tumor suppressor that is involved in preventing cancer.

Molecular Weight: 1066, 3