Product Overview
BCMA72-80 acetate(2293841-58-2 free base) | TP1806L | TargetMol Chemicals
CAS: TP1806L
Smiles: CC[C@H](C)[C@@H](C(O)=O)NC([C@H](CCCCN)NC([C@H](CCCNC(N)=N)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H](CC1=CC=CC=C1)NC([C@H](CCSC)NC([C@H](CC(C)C)NC([C@H](CC2=CC=C(O)C=C2)N)=O)=O)=O)=O)=O)=O)=O)=O.CC(O)=O
Formula: C61H101N13O13S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: BCMA72-80 acetate is a HLA-A2 specific B cell maturation antigen (BCMA) peptide. It is used to study multiple myeloma and tumors, which expresses B cell maturation antigen.
Molecular Weight: 1256, 6
