Product Overview
CLIP 86-100 acetate(648881-58-7 free base) | TP1573L | TargetMol Chemicals
CAS: TP1573L
Smiles: C[C@@H](C(O)=O)NC([C@H](CCC(N)=O)NC([C@H](CCSC)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H]1N(C([C@H]([C@H](O)C)NC([C@H](C)NC([C@H](CCSC)NC([C@H](CCCNC(N)=N)NC([C@H](CCSC)NC([C@H](CCCCN)NC([C@H](CO)NC([C@H](C(C)C)NC([C@H]2NCCC2)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)=O)=O.CC(O)=O
Formula: C74H132N20O21S3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: This is amino acids 86 to 100 fragment of class II-associated invariant chain peptide called CLIP. The major histocompatibility complex class II molecule displays peptide fragments of foreign proteins to trigger a defensive reaction from the immune system. Before insertion of the foreign peptides into the binding groove, a place-holding peptide CLIP is removed. This is accomplished by the molecule DM, which is shown to increase the dissociation rate of a CLIP peptide from class II.
Molecular Weight: 1734, 17
